C13H16F2N2O2 — CID 114224653
2-(3,3-difluorocyclohexyl)-1-(6-methoxypyrimidin-4-yl)ethanone (PubChem CID 114224653) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-1-(6-methoxypyrimidin-4-yl)ethanone.
| Compound Name | 2-(3,3-difluorocyclohexyl)-1-(6-methoxypyrimidin-4-yl)ethanone |
|---|---|
| PubChem CID | 114224653 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-1-(6-methoxypyrimidin-4-yl)ethanone |
| SMILES | COc1cc(C(=O)CC2CCCC(F)(F)C2)ncn1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-19-12-6-10(16-8-17-12)11(18)5-9-3-2-4-13(14,15)7-9/h6,8-9H,2-5,7H2,1H3 |
| InChIKey | YJEPNKLEJQCXLQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |