C12H21F2NO2 — CID 114225053
[4-[(3,3-difluorocyclohexyl)methyl]morpholin-3-yl]methanol (PubChem CID 114225053) has the molecular formula C12H21F2NO2 and a molecular weight of 249.30 g/mol. Its IUPAC name is [4-[(3,3-difluorocyclohexyl)methyl]morpholin-3-yl]methanol.
| Compound Name | [4-[(3,3-difluorocyclohexyl)methyl]morpholin-3-yl]methanol |
|---|---|
| PubChem CID | 114225053 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | [4-[(3,3-difluorocyclohexyl)methyl]morpholin-3-yl]methanol |
| SMILES | OCC1COCCN1CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H21F2NO2/c13-12(14)3-1-2-10(6-12)7-15-4-5-17-9-11(15)8-16/h10-11,16H,1-9H2 |
| InChIKey | RIYGDYVQBBORAH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |