C13H23F2NO — CID 114225039
[1-[(3,3-difluorocyclohexyl)methyl]piperidin-2-yl]methanol (PubChem CID 114225039) has the molecular formula C13H23F2NO and a molecular weight of 247.33 g/mol. Its IUPAC name is [1-[(3,3-difluorocyclohexyl)methyl]piperidin-2-yl]methanol.
| Compound Name | [1-[(3,3-difluorocyclohexyl)methyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 114225039 |
| Molecular Formula | C13H23F2NO |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | [1-[(3,3-difluorocyclohexyl)methyl]piperidin-2-yl]methanol |
| SMILES | OCC1CCCCN1CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H23F2NO/c14-13(15)6-3-4-11(8-13)9-16-7-2-1-5-12(16)10-17/h11-12,17H,1-10H2 |
| InChIKey | XGPNAKCDENQTDQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |