C13H23F2NO — CID 114225055
1-[(3,3-difluorocyclohexyl)methyl]-3-methylpiperidin-4-ol (PubChem CID 114225055) has the molecular formula C13H23F2NO and a molecular weight of 247.33 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclohexyl)methyl]-3-methylpiperidin-4-ol.
| Compound Name | 1-[(3,3-difluorocyclohexyl)methyl]-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 114225055 |
| Molecular Formula | C13H23F2NO |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-[(3,3-difluorocyclohexyl)methyl]-3-methylpiperidin-4-ol |
| SMILES | CC1CN(CC2CCCC(F)(F)C2)CCC1O |
| InChI | InChI=1S/C13H23F2NO/c1-10-8-16(6-4-12(10)17)9-11-3-2-5-13(14,15)7-11/h10-12,17H,2-9H2,1H3 |
| InChIKey | UQPIXBXUCJPUSK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |