C12H20F2N4 — CID 114225072
N-[[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]methyl]propan-1-amine (PubChem CID 114225072) has the molecular formula C12H20F2N4 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114225072 |
| Molecular Formula | C12H20F2N4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(CC2CCC(F)(F)C2)nn1 |
| InChI | InChI=1S/C12H20F2N4/c1-2-5-15-7-11-9-18(17-16-11)8-10-3-4-12(13,14)6-10/h9-10,15H,2-8H2,1H3 |
| InChIKey | LVHNZLGHABNCBD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|