C12H19F2N3O2S — CID 114225521
1-[(3,3-difluorocyclohexyl)methyl]-2-ethylimidazole-4-sulfonamide (PubChem CID 114225521) has the molecular formula C12H19F2N3O2S and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclohexyl)methyl]-2-ethylimidazole-4-sulfonamide.
| Compound Name | 1-[(3,3-difluorocyclohexyl)methyl]-2-ethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 114225521 |
| Molecular Formula | C12H19F2N3O2S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[(3,3-difluorocyclohexyl)methyl]-2-ethylimidazole-4-sulfonamide |
| SMILES | CCc1nc(S(N)(=O)=O)cn1CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H19F2N3O2S/c1-2-10-16-11(20(15,18)19)8-17(10)7-9-4-3-5-12(13,14)6-9/h8-9H,2-7H2,1H3,(H2,15,18,19) |
| InChIKey | PHZUOQVYAWFRQU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |