C15H27F3N2O4S2 — CID 175495041
1-butyl-2-hexan-3-yl-3-methylsulfonylimidazol-1-ium;trifluoromethanesulfinate (PubChem CID 175495041) has the molecular formula C15H27F3N2O4S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-butyl-2-hexan-3-yl-3-methylsulfonylimidazol-1-ium;trifluoromethanesulfinate.
| Compound Name | 1-butyl-2-hexan-3-yl-3-methylsulfonylimidazol-1-ium;trifluoromethanesulfinate |
|---|---|
| PubChem CID | 175495041 |
| Molecular Formula | C15H27F3N2O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-butyl-2-hexan-3-yl-3-methylsulfonylimidazol-1-ium;trifluoromethanesulfinate |
| SMILES | CCCC[n+]1ccn(S(C)(=O)=O)c1C(CC)CCC.O=S([O-])C(F)(F)F |
| InChI | InChI=1S/C14H27N2O2S.CHF3O2S/c1-5-8-10-15-11-12-16(19(4,17)18)14(15)13(7-3)9-6-2;2-1(3,4)7(5)6/h11-13H,5-10H2,1-4H3;(H,5,6)/q+1;/p-1 |
| InChIKey | RPBQHXAKTMBOKF-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|