C15H23F2NO — CID 114225536
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-2-(3,3-difluorocyclopentyl)ethanone (PubChem CID 114225536) has the molecular formula C15H23F2NO and a molecular weight of 271.35 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-2-(3,3-difluorocyclopentyl)ethanone.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-2-(3,3-difluorocyclopentyl)ethanone |
|---|---|
| PubChem CID | 114225536 |
| Molecular Formula | C15H23F2NO |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-2-(3,3-difluorocyclopentyl)ethanone |
| SMILES | O=C(CC1CCC(F)(F)C1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C15H23F2NO/c16-15(17)6-5-10(9-15)7-14(19)13-8-11-3-1-2-4-12(11)18-13/h10-13,18H,1-9H2 |
| InChIKey | QUHIGVRSBOIBPP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |