C12H16BrF2NS — CID 114225848
1-(5-bromothiophen-3-yl)-2-(3,3-difluorocyclohexyl)ethanamine (PubChem CID 114225848) has the molecular formula C12H16BrF2NS and a molecular weight of 324.23 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-2-(3,3-difluorocyclohexyl)ethanamine.
| Compound Name | 1-(5-bromothiophen-3-yl)-2-(3,3-difluorocyclohexyl)ethanamine |
|---|---|
| PubChem CID | 114225848 |
| Molecular Formula | C12H16BrF2NS |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-2-(3,3-difluorocyclohexyl)ethanamine |
| SMILES | NC(CC1CCCC(F)(F)C1)c1csc(Br)c1 |
| InChI | InChI=1S/C12H16BrF2NS/c13-11-5-9(7-17-11)10(16)4-8-2-1-3-12(14,15)6-8/h5,7-8,10H,1-4,6,16H2 |
| InChIKey | ZVTDRJYHZYELAG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |