C14H22BrF2NO — CID 114226636
[2-(3-bromopropyl)pyrrolidin-1-yl]-(3,3-difluorocyclohexyl)methanone (PubChem CID 114226636) has the molecular formula C14H22BrF2NO and a molecular weight of 338.24 g/mol. Its IUPAC name is [2-(3-bromopropyl)pyrrolidin-1-yl]-(3,3-difluorocyclohexyl)methanone.
| Compound Name | [2-(3-bromopropyl)pyrrolidin-1-yl]-(3,3-difluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 114226636 |
| Molecular Formula | C14H22BrF2NO |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [2-(3-bromopropyl)pyrrolidin-1-yl]-(3,3-difluorocyclohexyl)methanone |
| SMILES | O=C(C1CCCC(F)(F)C1)N1CCCC1CCCBr |
| InChI | InChI=1S/C14H22BrF2NO/c15-8-2-5-12-6-3-9-18(12)13(19)11-4-1-7-14(16,17)10-11/h11-12H,1-10H2 |
| InChIKey | IGSFFUXDXXAQFZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|