C11H14BrF6NO — CID 103310990
1-[2-(3-bromopropyl)pyrrolidin-1-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-one (PubChem CID 103310990) has the molecular formula C11H14BrF6NO and a molecular weight of 370.13 g/mol. Its IUPAC name is 1-[2-(3-bromopropyl)pyrrolidin-1-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-one.
| Compound Name | 1-[2-(3-bromopropyl)pyrrolidin-1-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-one |
|---|---|
| PubChem CID | 103310990 |
| Molecular Formula | C11H14BrF6NO |
| Molecular Weight | 370.13 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 1-[2-(3-bromopropyl)pyrrolidin-1-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-one |
| SMILES | O=C(C(C(F)(F)F)C(F)(F)F)N1CCCC1CCCBr |
| InChI | InChI=1S/C11H14BrF6NO/c12-5-1-3-7-4-2-6-19(7)9(20)8(10(13,14)15)11(16,17)18/h7-8H,1-6H2 |
| InChIKey | GCAIIZSXLBYMJG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|