C14H22ClF2NO — CID 114226677
[4-(1-chloroethyl)piperidin-1-yl]-(3,3-difluorocyclohexyl)methanone (PubChem CID 114226677) has the molecular formula C14H22ClF2NO and a molecular weight of 293.78 g/mol. Its IUPAC name is [4-(1-chloroethyl)piperidin-1-yl]-(3,3-difluorocyclohexyl)methanone.
| Compound Name | [4-(1-chloroethyl)piperidin-1-yl]-(3,3-difluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 114226677 |
| Molecular Formula | C14H22ClF2NO |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [4-(1-chloroethyl)piperidin-1-yl]-(3,3-difluorocyclohexyl)methanone |
| SMILES | CC(Cl)C1CCN(C(=O)C2CCCC(F)(F)C2)CC1 |
| InChI | InChI=1S/C14H22ClF2NO/c1-10(15)11-4-7-18(8-5-11)13(19)12-3-2-6-14(16,17)9-12/h10-12H,2-9H2,1H3 |
| InChIKey | JWUONYXHBBBAJW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|