C11H16F2N4 — CID 114226843
3-(3,3-difluorocyclopentyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 114226843) has the molecular formula C11H16F2N4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-(3,3-difluorocyclopentyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-(3,3-difluorocyclopentyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 114226843 |
| Molecular Formula | C11H16F2N4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-(3,3-difluorocyclopentyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | NC1CCc2nnc(C3CCC(F)(F)C3)n2C1 |
| InChI | InChI=1S/C11H16F2N4/c12-11(13)4-3-7(5-11)10-16-15-9-2-1-8(14)6-17(9)10/h7-8H,1-6,14H2 |
| InChIKey | OJXVFNUXQLKUJC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |