About N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine
N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine (PubChem CID 114229630) has the molecular formula C16H31N
and a molecular weight of 237.43 g/mol. Its IUPAC name is N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine |
| PubChem CID | 114229630 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine |
| SMILES | CC(C)NCC1C(C2CCCCCC2)C1(C)C |
| InChI | InChI=1S/C16H31N/c1-12(2)17-11-14-15(16(14,3)4)13-9-7-5-6-8-10-13/h12-15,17H,5-11H2,1-4H3 |
| InChIKey | OSWOEBJFUTYCGN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine?
The IUPAC name of N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine (CID 114229630) is N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine.
What is the SMILES notation for N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine?
The canonical SMILES for N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine is CC(C)NCC1C(C2CCCCCC2)C1(C)C.
What is the InChIKey of N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine?
The InChIKey is OSWOEBJFUTYCGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N/c1-12(2)17-11-14-15(16(14,3)4)13-9-7-5-6-8-10-13/h12-15,17H,5-11H2,1-4H3.
What are the key properties of N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine?
N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine has a molecular weight of 237.43 g/mol, XLogP of 4.23, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-cycloheptyl-2,2-dimethylcyclopropyl)methyl]propan-2-amine is sourced from PubChem (CID 114229630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).