C16H33N — CID 114229670
N-[(2-hexyl-2,3,3-trimethylcyclopropyl)methyl]propan-2-amine (PubChem CID 114229670) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is N-[(2-hexyl-2,3,3-trimethylcyclopropyl)methyl]propan-2-amine.
| Compound Name | N-[(2-hexyl-2,3,3-trimethylcyclopropyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 114229670 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | N-[(2-hexyl-2,3,3-trimethylcyclopropyl)methyl]propan-2-amine |
| SMILES | CCCCCCC1(C)C(CNC(C)C)C1(C)C |
| InChI | InChI=1S/C16H33N/c1-7-8-9-10-11-16(6)14(15(16,4)5)12-17-13(2)3/h13-14,17H,7-12H2,1-6H3 |
| InChIKey | ZUPYFPHYNJEAOA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|