C13H13BrF4 — CID 114230000
4-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-1-fluoro-2-(trifluoromethyl)benzene (PubChem CID 114230000) has the molecular formula C13H13BrF4 and a molecular weight of 325.14 g/mol. Its IUPAC name is 4-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-1-fluoro-2-(trifluoromethyl)benzene.
| Compound Name | 4-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-1-fluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 114230000 |
| Molecular Formula | C13H13BrF4 |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-1-fluoro-2-(trifluoromethyl)benzene |
| SMILES | CC1(C)C(CBr)C1c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13BrF4/c1-12(2)9(6-14)11(12)7-3-4-10(15)8(5-7)13(16,17)18/h3-5,9,11H,6H2,1-2H3 |
| InChIKey | XECYYOMDWZOGSC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|