C12H17BrFN3O — CID 114231146
2-[2-aminoethyl(ethyl)amino]-N-(4-bromo-2-fluorophenyl)acetamide (PubChem CID 114231146) has the molecular formula C12H17BrFN3O and a molecular weight of 318.19 g/mol. Its IUPAC name is 2-[2-aminoethyl(ethyl)amino]-N-(4-bromo-2-fluorophenyl)acetamide.
| Compound Name | 2-[2-aminoethyl(ethyl)amino]-N-(4-bromo-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 114231146 |
| Molecular Formula | C12H17BrFN3O |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-[2-aminoethyl(ethyl)amino]-N-(4-bromo-2-fluorophenyl)acetamide |
| SMILES | CCN(CCN)CC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H17BrFN3O/c1-2-17(6-5-15)8-12(18)16-11-4-3-9(13)7-10(11)14/h3-4,7H,2,5-6,8,15H2,1H3,(H,16,18) |
| InChIKey | BEBWHWPEVWLBPY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |