C15H21BrFN3O2 — CID 2549434
N-(4-bromo-2-fluorophenyl)-2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide (PubChem CID 2549434) has the molecular formula C15H21BrFN3O2 and a molecular weight of 374.25 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 2549434 |
| Molecular Formula | C15H21BrFN3O2 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(Br)cc1F)CC(=O)NC(C)C |
| InChI | InChI=1S/C15H21BrFN3O2/c1-4-20(8-14(21)18-10(2)3)9-15(22)19-13-6-5-11(16)7-12(13)17/h5-7,10H,4,8-9H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | FQRZCLVMSZWJEF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |