C12H16N4OS — CID 114231755
2-[(3-carbamimidoyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)sulfanyl]-N-methylacetamide (PubChem CID 114231755) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[(3-carbamimidoyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)sulfanyl]-N-methylacetamide.
| Compound Name | 2-[(3-carbamimidoyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)sulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 114231755 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[(3-carbamimidoyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)sulfanyl]-N-methylacetamide |
| SMILES | [H]/N=C(\N)c1cc2c(nc1SCC(=O)NC)CCC2 |
| InChI | InChI=1S/C12H16N4OS/c1-15-10(17)6-18-12-8(11(13)14)5-7-3-2-4-9(7)16-12/h5H,2-4,6H2,1H3,(H3,13,14)(H,15,17) |
| InChIKey | RPFSRFMISYUUNL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|