C12H18N2OS2 — CID 114233479
2-[2-amino-1-(3-methylthiophen-2-yl)ethyl]sulfanyl-N-cyclopropylacetamide (PubChem CID 114233479) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-[2-amino-1-(3-methylthiophen-2-yl)ethyl]sulfanyl-N-cyclopropylacetamide.
| Compound Name | 2-[2-amino-1-(3-methylthiophen-2-yl)ethyl]sulfanyl-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 114233479 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-[2-amino-1-(3-methylthiophen-2-yl)ethyl]sulfanyl-N-cyclopropylacetamide |
| SMILES | Cc1ccsc1C(CN)SCC(=O)NC1CC1 |
| InChI | InChI=1S/C12H18N2OS2/c1-8-4-5-16-12(8)10(6-13)17-7-11(15)14-9-2-3-9/h4-5,9-10H,2-3,6-7,13H2,1H3,(H,14,15) |
| InChIKey | CJZSVDBDRQQVLQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |