C11H14ClN3OS — CID 114233793
2-(4-carbamimidoyl-3-chlorophenyl)sulfanyl-N,N-dimethylacetamide (PubChem CID 114233793) has the molecular formula C11H14ClN3OS and a molecular weight of 271.77 g/mol. Its IUPAC name is 2-(4-carbamimidoyl-3-chlorophenyl)sulfanyl-N,N-dimethylacetamide.
| Compound Name | 2-(4-carbamimidoyl-3-chlorophenyl)sulfanyl-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 114233793 |
| Molecular Formula | C11H14ClN3OS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-(4-carbamimidoyl-3-chlorophenyl)sulfanyl-N,N-dimethylacetamide |
| SMILES | [H]/N=C(\N)c1ccc(SCC(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C11H14ClN3OS/c1-15(2)10(16)6-17-7-3-4-8(11(13)14)9(12)5-7/h3-5H,6H2,1-2H3,(H3,13,14) |
| InChIKey | SBMKZSYMXGQCED-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|