C12H18ClN3O — CID 79387914
2-chloro-4-[(2-hydroxy-2-methylpropyl)-methylamino]benzenecarboximidamide (PubChem CID 79387914) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 2-chloro-4-[(2-hydroxy-2-methylpropyl)-methylamino]benzenecarboximidamide.
| Compound Name | 2-chloro-4-[(2-hydroxy-2-methylpropyl)-methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 79387914 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-chloro-4-[(2-hydroxy-2-methylpropyl)-methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)CC(C)(C)O)cc1Cl |
| InChI | InChI=1S/C12H18ClN3O/c1-12(2,17)7-16(3)8-4-5-9(11(14)15)10(13)6-8/h4-6,17H,7H2,1-3H3,(H3,14,15) |
| InChIKey | WBXAKMSSBOWPMA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|