C13H15ClN4S — CID 62948030
2-chloro-4-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]benzenecarboximidamide (PubChem CID 62948030) has the molecular formula C13H15ClN4S and a molecular weight of 294.81 g/mol. Its IUPAC name is 2-chloro-4-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]benzenecarboximidamide.
| Compound Name | 2-chloro-4-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 62948030 |
| Molecular Formula | C13H15ClN4S |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-chloro-4-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)Cc2csc(C)n2)cc1Cl |
| InChI | InChI=1S/C13H15ClN4S/c1-8-17-9(7-19-8)6-18(2)10-3-4-11(13(15)16)12(14)5-10/h3-5,7H,6H2,1-2H3,(H3,15,16) |
| InChIKey | BWVRRLKNBFMRGE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|