C11H19N3S — CID 63177175
N,2,2-trimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanimidamide (PubChem CID 63177175) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is N,2,2-trimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanimidamide.
| Compound Name | N,2,2-trimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 63177175 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N,2,2-trimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanimidamide |
| SMILES | [H]/N=C(\N(C)Cc1csc(C)n1)C(C)(C)C |
| InChI | InChI=1S/C11H19N3S/c1-8-13-9(7-15-8)6-14(5)10(12)11(2,3)4/h7,12H,6H2,1-5H3/b12-10- |
| InChIKey | WRSNUPAAMMAHAK-BENRWUELSA-N |
| XLogP | 2.91 |
| TPSA | 39.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|