C12H16FNO2S — CID 114234790
N-ethyl-2-[2-fluoro-4-[(1S)-1-hydroxyethyl]phenyl]sulfanylacetamide (PubChem CID 114234790) has the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. Its IUPAC name is N-ethyl-2-[2-fluoro-4-[(1S)-1-hydroxyethyl]phenyl]sulfanylacetamide.
| Compound Name | N-ethyl-2-[2-fluoro-4-[(1S)-1-hydroxyethyl]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 114234790 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-ethyl-2-[2-fluoro-4-[(1S)-1-hydroxyethyl]phenyl]sulfanylacetamide |
| SMILES | CCNC(=O)CSc1ccc([C@H](C)O)cc1F |
| InChI | InChI=1S/C12H16FNO2S/c1-3-14-12(16)7-17-11-5-4-9(8(2)15)6-10(11)13/h4-6,8,15H,3,7H2,1-2H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | DQVWVKNULLWCMX-QMMMGPOBSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |