C18H26N4O2Se — CID 114235375
tert-butyl 4-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-3,3-dimethylpiperidine-1-carboxylate (PubChem CID 114235375) has the molecular formula C18H26N4O2Se and a molecular weight of 409.39 g/mol. Its IUPAC name is tert-butyl 4-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-3,3-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-3,3-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 114235375 |
| Molecular Formula | C18H26N4O2Se |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | tert-butyl 4-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-3,3-dimethylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cccc3c2N=[Se]=N3)C(C)(C)C1 |
| InChI | InChI=1S/C18H26N4O2Se/c1-17(2,3)24-16(23)22-10-9-14(18(4,5)11-22)19-12-7-6-8-13-15(12)21-25-20-13/h6-8,14,19H,9-11H2,1-5H3 |
| InChIKey | OIAKIJMUOAGSPN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|