C13H18BrFN2 — CID 114235564
N-(2-bromo-5-fluorophenyl)-3,3-dimethylpiperidin-4-amine (PubChem CID 114235564) has the molecular formula C13H18BrFN2 and a molecular weight of 301.20 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-3,3-dimethylpiperidin-4-amine.
| Compound Name | N-(2-bromo-5-fluorophenyl)-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 114235564 |
| Molecular Formula | C13H18BrFN2 |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-3,3-dimethylpiperidin-4-amine |
| SMILES | CC1(C)CNCCC1Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C13H18BrFN2/c1-13(2)8-16-6-5-12(13)17-11-7-9(15)3-4-10(11)14/h3-4,7,12,16-17H,5-6,8H2,1-2H3 |
| InChIKey | QHWBZDNGZRCWKI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |