C14H19N3S — CID 114237200
6-methyl-2-(4-methylsulfanylazepan-1-yl)pyridine-3-carbonitrile (PubChem CID 114237200) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 6-methyl-2-(4-methylsulfanylazepan-1-yl)pyridine-3-carbonitrile.
| Compound Name | 6-methyl-2-(4-methylsulfanylazepan-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 114237200 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 6-methyl-2-(4-methylsulfanylazepan-1-yl)pyridine-3-carbonitrile |
| SMILES | CSC1CCCN(c2nc(C)ccc2C#N)CC1 |
| InChI | InChI=1S/C14H19N3S/c1-11-5-6-12(10-15)14(16-11)17-8-3-4-13(18-2)7-9-17/h5-6,13H,3-4,7-9H2,1-2H3 |
| InChIKey | GJBJXILMVSUDKX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |