C18H21N3O2 — CID 75375987
pent-4-ynyl 1-(3-cyano-6-methyl-2-pyridinyl)piperidine-3-carboxylate (PubChem CID 75375987) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is pent-4-ynyl 1-(3-cyano-6-methyl-2-pyridinyl)piperidine-3-carboxylate.
| Compound Name | pent-4-ynyl 1-(3-cyano-6-methyl-2-pyridinyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 75375987 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | pent-4-ynyl 1-(3-cyano-6-methyl-2-pyridinyl)piperidine-3-carboxylate |
| SMILES | C#CCCCOC(=O)C1CCCN(c2nc(C)ccc2C#N)C1 |
| InChI | InChI=1S/C18H21N3O2/c1-3-4-5-11-23-18(22)16-7-6-10-21(13-16)17-15(12-19)9-8-14(2)20-17/h1,8-9,16H,4-7,10-11,13H2,2H3 |
| InChIKey | NNOOHBQVSDVJIP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|