C19H27N5O2 — CID 56882105
ethyl 4-[1-(3-cyano-6-methyl-2-pyridinyl)piperidin-3-yl]piperazine-1-carboxylate (PubChem CID 56882105) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is ethyl 4-[1-(3-cyano-6-methyl-2-pyridinyl)piperidin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(3-cyano-6-methyl-2-pyridinyl)piperidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 56882105 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | ethyl 4-[1-(3-cyano-6-methyl-2-pyridinyl)piperidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2CCCN(c3nc(C)ccc3C#N)C2)CC1 |
| InChI | InChI=1S/C19H27N5O2/c1-3-26-19(25)23-11-9-22(10-12-23)17-5-4-8-24(14-17)18-16(13-20)7-6-15(2)21-18/h6-7,17H,3-5,8-12,14H2,1-2H3 |
| InChIKey | CYRNGHCEVQDBQQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |