C13H18N2O2S — CID 114237506
6-(4-methylsulfanylazepan-1-yl)pyridine-3-carboxylic acid (PubChem CID 114237506) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 6-(4-methylsulfanylazepan-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 6-(4-methylsulfanylazepan-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114237506 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 6-(4-methylsulfanylazepan-1-yl)pyridine-3-carboxylic acid |
| SMILES | CSC1CCCN(c2ccc(C(=O)O)cn2)CC1 |
| InChI | InChI=1S/C13H18N2O2S/c1-18-11-3-2-7-15(8-6-11)12-5-4-10(9-14-12)13(16)17/h4-5,9,11H,2-3,6-8H2,1H3,(H,16,17) |
| InChIKey | GWFCGISNHMEVRO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |