C13H24N2S2 — CID 114238261
N-[[5-(ethylaminomethyl)thiophen-2-yl]methyl]-N-methyl-3-methylsulfanylpropan-1-amine (PubChem CID 114238261) has the molecular formula C13H24N2S2 and a molecular weight of 272.48 g/mol. Its IUPAC name is N-[[5-(ethylaminomethyl)thiophen-2-yl]methyl]-N-methyl-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[[5-(ethylaminomethyl)thiophen-2-yl]methyl]-N-methyl-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 114238261 |
| Molecular Formula | C13H24N2S2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | N-[[5-(ethylaminomethyl)thiophen-2-yl]methyl]-N-methyl-3-methylsulfanylpropan-1-amine |
| SMILES | CCNCc1ccc(CN(C)CCCSC)s1 |
| InChI | InChI=1S/C13H24N2S2/c1-4-14-10-12-6-7-13(17-12)11-15(2)8-5-9-16-3/h6-7,14H,4-5,8-11H2,1-3H3 |
| InChIKey | FFPIYUZMDJKGLH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|