C12H18N4OS — CID 114238348
[5-(methylamino)pyrazin-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone (PubChem CID 114238348) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is [5-(methylamino)pyrazin-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone.
| Compound Name | [5-(methylamino)pyrazin-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 114238348 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [5-(methylamino)pyrazin-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone |
| SMILES | CNc1cnc(C(=O)N2CCC(SC)CC2)cn1 |
| InChI | InChI=1S/C12H18N4OS/c1-13-11-8-14-10(7-15-11)12(17)16-5-3-9(18-2)4-6-16/h7-9H,3-6H2,1-2H3,(H,13,15) |
| InChIKey | MVOYDONYPXCIBZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |