C17H19N5O3 — CID 109271816
[4-[5-(cyclopropylamino)pyrazine-2-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 109271816) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is [4-[5-(cyclopropylamino)pyrazine-2-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[5-(cyclopropylamino)pyrazine-2-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 109271816 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [4-[5-(cyclopropylamino)pyrazine-2-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1cnc(NC2CC2)cn1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H19N5O3/c23-16(13-10-19-15(11-18-13)20-12-3-4-12)21-5-7-22(8-6-21)17(24)14-2-1-9-25-14/h1-2,9-12H,3-8H2,(H,19,20) |
| InChIKey | IZKNGABNFRUUNL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |