C20H20N6O3 — CID 109283092
furan-2-yl-[4-[5-(pyridin-2-ylmethylamino)pyrazine-2-carbonyl]piperazin-1-yl]methanone (PubChem CID 109283092) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is furan-2-yl-[4-[5-(pyridin-2-ylmethylamino)pyrazine-2-carbonyl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[5-(pyridin-2-ylmethylamino)pyrazine-2-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 109283092 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | furan-2-yl-[4-[5-(pyridin-2-ylmethylamino)pyrazine-2-carbonyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cnc(NCc2ccccn2)cn1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H20N6O3/c27-19(25-7-9-26(10-8-25)20(28)17-5-3-11-29-17)16-13-24-18(14-22-16)23-12-15-4-1-2-6-21-15/h1-6,11,13-14H,7-10,12H2,(H,23,24) |
| InChIKey | XBWZZHQSPLYFRX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |