C21H21FN6O — CID 109281692
[5-[(4-fluorophenyl)methylamino]pyrazin-2-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 109281692) has the molecular formula C21H21FN6O and a molecular weight of 392.44 g/mol. Its IUPAC name is [5-[(4-fluorophenyl)methylamino]pyrazin-2-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [5-[(4-fluorophenyl)methylamino]pyrazin-2-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109281692 |
| Molecular Formula | C21H21FN6O |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [5-[(4-fluorophenyl)methylamino]pyrazin-2-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cnc(NCc2ccc(F)cc2)cn1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H21FN6O/c22-17-6-4-16(5-7-17)13-25-19-15-24-18(14-26-19)21(29)28-11-9-27(10-12-28)20-3-1-2-8-23-20/h1-8,14-15H,9-13H2,(H,25,26) |
| InChIKey | ABBVBTJMHQORKO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |