C16H16F3N3O3 — CID 133489078
furan-2-yl-[4-[[5-(trifluoromethoxy)-2-pyridinyl]amino]piperidin-1-yl]methanone (PubChem CID 133489078) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is furan-2-yl-[4-[[5-(trifluoromethoxy)-2-pyridinyl]amino]piperidin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[[5-(trifluoromethoxy)-2-pyridinyl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 133489078 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | furan-2-yl-[4-[[5-(trifluoromethoxy)-2-pyridinyl]amino]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCC(Nc2ccc(OC(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H16F3N3O3/c17-16(18,19)25-12-3-4-14(20-10-12)21-11-5-7-22(8-6-11)15(23)13-2-1-9-24-13/h1-4,9-11H,5-8H2,(H,20,21) |
| InChIKey | FBZRIGDRHOUPIK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |