C11H16ClNO3S2 — CID 114238587
1-[5-(chloromethyl)furan-2-yl]sulfonyl-4-methylsulfanylpiperidine (PubChem CID 114238587) has the molecular formula C11H16ClNO3S2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 1-[5-(chloromethyl)furan-2-yl]sulfonyl-4-methylsulfanylpiperidine.
| Compound Name | 1-[5-(chloromethyl)furan-2-yl]sulfonyl-4-methylsulfanylpiperidine |
|---|---|
| PubChem CID | 114238587 |
| Molecular Formula | C11H16ClNO3S2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 1-[5-(chloromethyl)furan-2-yl]sulfonyl-4-methylsulfanylpiperidine |
| SMILES | CSC1CCN(S(=O)(=O)c2ccc(CCl)o2)CC1 |
| InChI | InChI=1S/C11H16ClNO3S2/c1-17-10-4-6-13(7-5-10)18(14,15)11-3-2-9(8-12)16-11/h2-3,10H,4-8H2,1H3 |
| InChIKey | FKJQANRCGVCHDK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|