C15H27NO2 — CID 114242563
methyl 2-[(3,3,5,5-tetramethylcyclohexyl)amino]but-3-enoate (PubChem CID 114242563) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is methyl 2-[(3,3,5,5-tetramethylcyclohexyl)amino]but-3-enoate.
| Compound Name | methyl 2-[(3,3,5,5-tetramethylcyclohexyl)amino]but-3-enoate |
|---|---|
| PubChem CID | 114242563 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | methyl 2-[(3,3,5,5-tetramethylcyclohexyl)amino]but-3-enoate |
| SMILES | C=CC(NC1CC(C)(C)CC(C)(C)C1)C(=O)OC |
| InChI | InChI=1S/C15H27NO2/c1-7-12(13(17)18-6)16-11-8-14(2,3)10-15(4,5)9-11/h7,11-12,16H,1,8-10H2,2-6H3 |
| InChIKey | IGZLCXAIOLFZOV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|