C13H27NO3 — CID 114242927
2-[2-[methyl-(2,2,5,5-tetramethyloxolan-3-yl)amino]ethoxy]ethanol (PubChem CID 114242927) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is 2-[2-[methyl-(2,2,5,5-tetramethyloxolan-3-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[methyl-(2,2,5,5-tetramethyloxolan-3-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 114242927 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 2-[2-[methyl-(2,2,5,5-tetramethyloxolan-3-yl)amino]ethoxy]ethanol |
| SMILES | CN(CCOCCO)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H27NO3/c1-12(2)10-11(13(3,4)17-12)14(5)6-8-16-9-7-15/h11,15H,6-10H2,1-5H3 |
| InChIKey | DRAYWWQJRFNOAR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|