C12H18ClN3O2 — CID 114243127
3-chloro-4-[2-(2-hydroxyethoxy)ethyl-methylamino]benzenecarboximidamide (PubChem CID 114243127) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 3-chloro-4-[2-(2-hydroxyethoxy)ethyl-methylamino]benzenecarboximidamide.
| Compound Name | 3-chloro-4-[2-(2-hydroxyethoxy)ethyl-methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 114243127 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-chloro-4-[2-(2-hydroxyethoxy)ethyl-methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)CCOCCO)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClN3O2/c1-16(4-6-18-7-5-17)11-3-2-9(12(14)15)8-10(11)13/h2-3,8,17H,4-7H2,1H3,(H3,14,15) |
| InChIKey | WEQDLVSIDPPCJM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|