C10H12F3NO2S — CID 114243948
(2R)-1-amino-3-[3-(trifluoromethyl)phenyl]sulfinylpropan-2-ol (PubChem CID 114243948) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is (2R)-1-amino-3-[3-(trifluoromethyl)phenyl]sulfinylpropan-2-ol.
| Compound Name | (2R)-1-amino-3-[3-(trifluoromethyl)phenyl]sulfinylpropan-2-ol |
|---|---|
| PubChem CID | 114243948 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | (2R)-1-amino-3-[3-(trifluoromethyl)phenyl]sulfinylpropan-2-ol |
| SMILES | NC[C@@H](O)CS(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3NO2S/c11-10(12,13)7-2-1-3-9(4-7)17(16)6-8(15)5-14/h1-4,8,15H,5-6,14H2/t8-,17?/m1/s1 |
| InChIKey | CJNBLAIHTKEJKZ-OEWHWVHBSA-N |
| XLogP | 1.13 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |