C12H14F3N3O3S — CID 86655266
1-azido-3-methyl-3-[3-(trifluoromethyl)phenyl]sulfonylbutan-2-ol (PubChem CID 86655266) has the molecular formula C12H14F3N3O3S and a molecular weight of 337.32 g/mol. Its IUPAC name is 1-azido-3-methyl-3-[3-(trifluoromethyl)phenyl]sulfonylbutan-2-ol.
| Compound Name | 1-azido-3-methyl-3-[3-(trifluoromethyl)phenyl]sulfonylbutan-2-ol |
|---|---|
| PubChem CID | 86655266 |
| Molecular Formula | C12H14F3N3O3S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-azido-3-methyl-3-[3-(trifluoromethyl)phenyl]sulfonylbutan-2-ol |
| SMILES | CC(C)(C(O)CN=[N+]=[N-])S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N3O3S/c1-11(2,10(19)7-17-18-16)22(20,21)9-5-3-4-8(6-9)12(13,14)15/h3-6,10,19H,7H2,1-2H3 |
| InChIKey | MLGQFQPAPHBDFC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|