C12H9BrN2O3S — CID 114244409
4-[(4-bromothiophen-2-yl)methylcarbamoyl]pyridine-3-carboxylic acid (PubChem CID 114244409) has the molecular formula C12H9BrN2O3S and a molecular weight of 341.19 g/mol. Its IUPAC name is 4-[(4-bromothiophen-2-yl)methylcarbamoyl]pyridine-3-carboxylic acid.
| Compound Name | 4-[(4-bromothiophen-2-yl)methylcarbamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114244409 |
| Molecular Formula | C12H9BrN2O3S |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 4-[(4-bromothiophen-2-yl)methylcarbamoyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnccc1C(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H9BrN2O3S/c13-7-3-8(19-6-7)4-15-11(16)9-1-2-14-5-10(9)12(17)18/h1-3,5-6H,4H2,(H,15,16)(H,17,18) |
| InChIKey | KRRSJRHLROGPIW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |