C14H18O2 — CID 11424515
2-cyclohex-2-en-1-yl-1,3-dimethoxybenzene (PubChem CID 11424515) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-yl-1,3-dimethoxybenzene.
| Compound Name | 2-cyclohex-2-en-1-yl-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 11424515 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-cyclohex-2-en-1-yl-1,3-dimethoxybenzene |
| SMILES | COc1cccc(OC)c1C1C=CCCC1 |
| InChI | InChI=1S/C14H18O2/c1-15-12-9-6-10-13(16-2)14(12)11-7-4-3-5-8-11/h4,6-7,9-11H,3,5,8H2,1-2H3 |
| InChIKey | KNCVWGZUOBHEID-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|