C20H21FO2 — CID 139334388
1-cyclohex-2-en-1-yl-2-fluoro-4-[(4-methoxyphenyl)methoxy]benzene (PubChem CID 139334388) has the molecular formula C20H21FO2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-2-fluoro-4-[(4-methoxyphenyl)methoxy]benzene.
| Compound Name | 1-cyclohex-2-en-1-yl-2-fluoro-4-[(4-methoxyphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 139334388 |
| Molecular Formula | C20H21FO2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-2-fluoro-4-[(4-methoxyphenyl)methoxy]benzene |
| SMILES | COc1ccc(COc2ccc(C3C=CCCC3)c(F)c2)cc1 |
| InChI | InChI=1S/C20H21FO2/c1-22-17-9-7-15(8-10-17)14-23-18-11-12-19(20(21)13-18)16-5-3-2-4-6-16/h3,5,7-13,16H,2,4,6,14H2,1H3 |
| InChIKey | OBQMFCFNQVGRKW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|