C16H16F2O5S — CID 118455182
[2,6-difluoro-4-[(4-methoxyphenyl)methoxy]phenyl]methyl methanesulfonate (PubChem CID 118455182) has the molecular formula C16H16F2O5S and a molecular weight of 358.36 g/mol. Its IUPAC name is [2,6-difluoro-4-[(4-methoxyphenyl)methoxy]phenyl]methyl methanesulfonate.
| Compound Name | [2,6-difluoro-4-[(4-methoxyphenyl)methoxy]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 118455182 |
| Molecular Formula | C16H16F2O5S |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [2,6-difluoro-4-[(4-methoxyphenyl)methoxy]phenyl]methyl methanesulfonate |
| SMILES | COc1ccc(COc2cc(F)c(COS(C)(=O)=O)c(F)c2)cc1 |
| InChI | InChI=1S/C16H16F2O5S/c1-21-12-5-3-11(4-6-12)9-22-13-7-15(17)14(16(18)8-13)10-23-24(2,19)20/h3-8H,9-10H2,1-2H3 |
| InChIKey | ALCWVYAQRPHYTQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|