C15H17FN2O4S — CID 59184646
[2-fluoro-6-[(4-methoxyphenyl)methylamino]-4-pyridinyl]methyl methanesulfonate (PubChem CID 59184646) has the molecular formula C15H17FN2O4S and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-fluoro-6-[(4-methoxyphenyl)methylamino]-4-pyridinyl]methyl methanesulfonate.
| Compound Name | [2-fluoro-6-[(4-methoxyphenyl)methylamino]-4-pyridinyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 59184646 |
| Molecular Formula | C15H17FN2O4S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [2-fluoro-6-[(4-methoxyphenyl)methylamino]-4-pyridinyl]methyl methanesulfonate |
| SMILES | COc1ccc(CNc2cc(COS(C)(=O)=O)cc(F)n2)cc1 |
| InChI | InChI=1S/C15H17FN2O4S/c1-21-13-5-3-11(4-6-13)9-17-15-8-12(7-14(16)18-15)10-22-23(2,19)20/h3-8H,9-10H2,1-2H3,(H,17,18) |
| InChIKey | ZSMGAKZYFUWOGC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|