C15H16F2N2O2 — CID 142781414
1-[2,3-difluoro-6-[(4-methoxyphenyl)methylamino]-4-pyridinyl]ethanol (PubChem CID 142781414) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 1-[2,3-difluoro-6-[(4-methoxyphenyl)methylamino]-4-pyridinyl]ethanol.
| Compound Name | 1-[2,3-difluoro-6-[(4-methoxyphenyl)methylamino]-4-pyridinyl]ethanol |
|---|---|
| PubChem CID | 142781414 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-[2,3-difluoro-6-[(4-methoxyphenyl)methylamino]-4-pyridinyl]ethanol |
| SMILES | COc1ccc(CNc2cc(C(C)O)c(F)c(F)n2)cc1 |
| InChI | InChI=1S/C15H16F2N2O2/c1-9(20)12-7-13(19-15(17)14(12)16)18-8-10-3-5-11(21-2)6-4-10/h3-7,9,20H,8H2,1-2H3,(H,18,19) |
| InChIKey | WEWLLAVJNLDBIT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|