C22H21FN4O2 — CID 129172188
[2-fluoro-6-[(4-methoxyphenyl)methylamino]-3-pyridinyl]-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol (PubChem CID 129172188) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is [2-fluoro-6-[(4-methoxyphenyl)methylamino]-3-pyridinyl]-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol.
| Compound Name | [2-fluoro-6-[(4-methoxyphenyl)methylamino]-3-pyridinyl]-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 129172188 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [2-fluoro-6-[(4-methoxyphenyl)methylamino]-3-pyridinyl]-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol |
| SMILES | COc1ccc(CNc2ccc(C(O)c3c[nH]c4ncc(C)cc34)c(F)n2)cc1 |
| InChI | InChI=1S/C22H21FN4O2/c1-13-9-17-18(12-26-22(17)25-10-13)20(28)16-7-8-19(27-21(16)23)24-11-14-3-5-15(29-2)6-4-14/h3-10,12,20,28H,11H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | PFCUQLADYORBSO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|